About 2-methylprop-2-enamide;hydrate
2-methylprop-2-enamide;hydrate (PubChem CID 88749193) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is 2-methylprop-2-enamide;hydrate.
Molecular Properties
| Compound Name | 2-methylprop-2-enamide;hydrate |
| PubChem CID | 88749193 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 2-methylprop-2-enamide;hydrate |
| SMILES | C=C(C)C(N)=O.O |
| InChI | InChI=1S/C4H7NO.H2O/c1-3(2)4(5)6;/h1H2,2H3,(H2,5,6);1H2 |
| InChIKey | AQNRMKXZLTVWIL-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enamide;hydrate?
The IUPAC name of 2-methylprop-2-enamide;hydrate (CID 88749193) is 2-methylprop-2-enamide;hydrate.
What is the SMILES notation for 2-methylprop-2-enamide;hydrate?
The canonical SMILES for 2-methylprop-2-enamide;hydrate is C=C(C)C(N)=O.O.
What is the InChIKey of 2-methylprop-2-enamide;hydrate?
The InChIKey is AQNRMKXZLTVWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.H2O/c1-3(2)4(5)6;/h1H2,2H3,(H2,5,6);1H2.
What are the key properties of 2-methylprop-2-enamide;hydrate?
2-methylprop-2-enamide;hydrate has a molecular weight of 103.12 g/mol, XLogP of -0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enamide;hydrate is sourced from PubChem (CID 88749193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).