C8H17N2O6P — CID 87675275
bis(2-methylprop-2-enamide);phosphoric acid (PubChem CID 87675275) has the molecular formula C8H17N2O6P and a molecular weight of 268.21 g/mol. Its IUPAC name is bis(2-methylprop-2-enamide);phosphoric acid.
| Compound Name | bis(2-methylprop-2-enamide);phosphoric acid |
|---|---|
| PubChem CID | 87675275 |
| Molecular Formula | C8H17N2O6P |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | bis(2-methylprop-2-enamide);phosphoric acid |
| SMILES | C=C(C)C(N)=O.C=C(C)C(N)=O.O=P(O)(O)O |
| InChI | InChI=1S/2C4H7NO.H3O4P/c2*1-3(2)4(5)6;1-5(2,3)4/h2*1H2,2H3,(H2,5,6);(H3,1,2,3,4) |
| InChIKey | DPDALVYGIWYRPX-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|