C14H28N2O4 — CID 122530831
hexane-1,6-diol;bis(2-methylprop-2-enamide) (PubChem CID 122530831) has the molecular formula C14H28N2O4 and a molecular weight of 288.39 g/mol. Its IUPAC name is hexane-1,6-diol;bis(2-methylprop-2-enamide).
| Compound Name | hexane-1,6-diol;bis(2-methylprop-2-enamide) |
|---|---|
| PubChem CID | 122530831 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | hexane-1,6-diol;bis(2-methylprop-2-enamide) |
| SMILES | C=C(C)C(N)=O.C=C(C)C(N)=O.OCCCCCCO |
| InChI | InChI=1S/C6H14O2.2C4H7NO/c7-5-3-1-2-4-6-8;2*1-3(2)4(5)6/h7-8H,1-6H2;2*1H2,2H3,(H2,5,6) |
| InChIKey | NZPQFKNVLOXION-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|