C23H42O6 — CID 90169594
hexane-1,6-diol;9-(2-methylprop-2-enoyloxy)nonyl 2-methylprop-2-enoate (PubChem CID 90169594) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is hexane-1,6-diol;9-(2-methylprop-2-enoyloxy)nonyl 2-methylprop-2-enoate.
| Compound Name | hexane-1,6-diol;9-(2-methylprop-2-enoyloxy)nonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90169594 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | hexane-1,6-diol;9-(2-methylprop-2-enoyloxy)nonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCOC(=O)C(=C)C.OCCCCCCO |
| InChI | InChI=1S/C17H28O4.C6H14O2/c1-14(2)16(18)20-12-10-8-6-5-7-9-11-13-21-17(19)15(3)4;7-5-3-1-2-4-6-8/h1,3,5-13H2,2,4H3;7-8H,1-6H2 |
| InChIKey | WTYDAOFGCDLLNI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|