About 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate
2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate (PubChem CID 141150360) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate |
| PubChem CID | 141150360 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCCCCCO |
| InChI | InChI=1S/C14H24O5/c1-12(2)14(17)19-11-10-18-13(16)8-6-4-3-5-7-9-15/h15H,1,3-11H2,2H3 |
| InChIKey | IHOIGQCGGHLHTD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate (CID 141150360) is 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate is C=C(C)C(=O)OCCOC(=O)CCCCCCCO.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate?
The InChIKey is IHOIGQCGGHLHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O5/c1-12(2)14(17)19-11-10-18-13(16)8-6-4-3-5-7-9-15/h15H,1,3-11H2,2H3.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate?
2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate has a molecular weight of 272.34 g/mol, XLogP of 1.98, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 8-hydroxyoctanoate is sourced from PubChem (CID 141150360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).