C18H30O6 — CID 155658741
6-[8-(2-methylprop-2-enoyloxy)octoxy]-6-oxohexanoic acid (PubChem CID 155658741) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 6-[8-(2-methylprop-2-enoyloxy)octoxy]-6-oxohexanoic acid.
| Compound Name | 6-[8-(2-methylprop-2-enoyloxy)octoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 155658741 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 6-[8-(2-methylprop-2-enoyloxy)octoxy]-6-oxohexanoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCOC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C18H30O6/c1-15(2)18(22)24-14-10-6-4-3-5-9-13-23-17(21)12-8-7-11-16(19)20/h1,3-14H2,2H3,(H,19,20) |
| InChIKey | PDIJIXLEDCHMDJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|