C26H42NO10+ — CID 158601031
4-carboxybutyl-methyl-bis[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]azanium (PubChem CID 158601031) has the molecular formula C26H42NO10+ and a molecular weight of 528.62 g/mol. Its IUPAC name is 4-carboxybutyl-methyl-bis[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]azanium.
| Compound Name | 4-carboxybutyl-methyl-bis[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]azanium |
|---|---|
| PubChem CID | 158601031 |
| Molecular Formula | C26H42NO10+ |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 4-carboxybutyl-methyl-bis[2-[4-(2-methylprop-2-enoyloxy)butanoyloxy]ethyl]azanium |
| SMILES | C=C(C)C(=O)OCCCC(=O)OCC[N+](C)(CCCCC(=O)O)CCOC(=O)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C26H41NO10/c1-20(2)25(32)36-16-8-11-23(30)34-18-14-27(5,13-7-6-10-22(28)29)15-19-35-24(31)12-9-17-37-26(33)21(3)4/h1,3,6-19H2,2,4-5H3/p+1 |
| InChIKey | LJCBOWYHYNKLIO-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|