C22H38NO8+ — CID 123840070
butyl-methyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]-[3-oxo-3-(2-propanoyloxyethoxy)propyl]azanium (PubChem CID 123840070) has the molecular formula C22H38NO8+ and a molecular weight of 444.55 g/mol. Its IUPAC name is butyl-methyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]-[3-oxo-3-(2-propanoyloxyethoxy)propyl]azanium.
| Compound Name | butyl-methyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]-[3-oxo-3-(2-propanoyloxyethoxy)propyl]azanium |
|---|---|
| PubChem CID | 123840070 |
| Molecular Formula | C22H38NO8+ |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | butyl-methyl-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]-[3-oxo-3-(2-propanoyloxyethoxy)propyl]azanium |
| SMILES | C=C(C)C(=O)OCCOC(=O)CC[N+](C)(CCCC)CCC(=O)OCCOC(=O)CC |
| InChI | InChI=1S/C22H38NO8/c1-6-8-11-23(5,12-9-20(25)29-15-14-28-19(24)7-2)13-10-21(26)30-16-17-31-22(27)18(3)4/h3,6-17H2,1-2,4-5H3/q+1 |
| InChIKey | GFUXXSNKOKQXSU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|