About 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate
2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate (PubChem CID 58942580) has the molecular formula C10H13ClO5
and a molecular weight of 248.66 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate |
| PubChem CID | 58942580 |
| Molecular Formula | C10H13ClO5 |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)Cl |
| InChI | InChI=1S/C10H13ClO5/c1-7(2)10(14)16-6-5-15-9(13)4-3-8(11)12/h1,3-6H2,2H3 |
| InChIKey | BYUXMRWGYGNGMT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate?
The IUPAC name of 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate (CID 58942580) is 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate.
What is the SMILES notation for 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate?
The canonical SMILES for 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate is C=C(C)C(=O)OCCOC(=O)CCC(=O)Cl.
What is the InChIKey of 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate?
The InChIKey is BYUXMRWGYGNGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO5/c1-7(2)10(14)16-6-5-15-9(13)4-3-8(11)12/h1,3-6H2,2H3.
What are the key properties of 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate?
2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate has a molecular weight of 248.66 g/mol, XLogP of 1.19, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylprop-2-enoyloxy)ethyl 4-chloro-4-oxobutanoate is sourced from PubChem (CID 58942580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).