C9H13ClO4 — CID 87696960
2-(3-chloro-3-oxopropoxy)ethyl 2-methylprop-2-enoate (PubChem CID 87696960) has the molecular formula C9H13ClO4 and a molecular weight of 220.65 g/mol. Its IUPAC name is 2-(3-chloro-3-oxopropoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3-chloro-3-oxopropoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87696960 |
| Molecular Formula | C9H13ClO4 |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(3-chloro-3-oxopropoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCC(=O)Cl |
| InChI | InChI=1S/C9H13ClO4/c1-7(2)9(12)14-6-5-13-4-3-8(10)11/h1,3-6H2,2H3 |
| InChIKey | GWNDWCHYDIRMFS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|