C20H30O9 — CID 158009828
bis(2-methylprop-2-enoic acid);2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 158009828) has the molecular formula C20H30O9 and a molecular weight of 414.45 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | bis(2-methylprop-2-enoic acid);2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158009828 |
| Molecular Formula | C20H30O9 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)OCCOCCOC(=O)C(=C)C |
| InChI | InChI=1S/C12H18O5.2C4H6O2/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4;2*1-3(2)4(5)6/h1,3,5-8H2,2,4H3;2*1H2,2H3,(H,5,6) |
| InChIKey | FESZSVGASXFTMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|