C8H15NO3 — CID 20573934
2-(2-aminoethoxy)ethyl 2-methylprop-2-enoate (PubChem CID 20573934) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2-aminoethoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20573934 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCN |
| InChI | InChI=1S/C8H15NO3/c1-7(2)8(10)12-6-5-11-4-3-9/h1,3-6,9H2,2H3 |
| InChIKey | XEXAZMUXZYILPC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|