C8H19NO2 — CID 158487497
2-aminoethyl 2-methylprop-2-enoate;methane (PubChem CID 158487497) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-aminoethyl 2-methylprop-2-enoate;methane.
| Compound Name | 2-aminoethyl 2-methylprop-2-enoate;methane |
|---|---|
| PubChem CID | 158487497 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 2-aminoethyl 2-methylprop-2-enoate;methane |
| SMILES | C.C.C=C(C)C(=O)OCCN |
| InChI | InChI=1S/C6H11NO2.2CH4/c1-5(2)6(8)9-4-3-7;;/h1,3-4,7H2,2H3;2*1H4 |
| InChIKey | HIGVQIMRZVKCHQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|