2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid

C9H15NO4 — CID 155355138

IUPAC2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid
SMILESC=C(C)C(=O)OCCN.C=CC(=O)O
InChIInChI=1S/C6H11NO2.C3H4O2/c1-5(2)6(8)9-4-3-7;1-2-3(4)5/h1,3-4,7H2,2H3;2H,1H2,(H,4,5)
InChIKeyXGZDAGGOXCSMHJ-UHFFFAOYSA-N
MW201.22 g/mol
LogP0.32
Rot. Bonds4

About 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid

2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 155355138) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid.

Molecular Properties

Compound Name2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid
PubChem CID155355138
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid
SMILESC=C(C)C(=O)OCCN.C=CC(=O)O
InChIInChI=1S/C6H11NO2.C3H4O2/c1-5(2)6(8)9-4-3-7;1-2-3(4)5/h1,3-4,7H2,2H3;2H,1H2,(H,4,5)
InChIKeyXGZDAGGOXCSMHJ-UHFFFAOYSA-N
XLogP0.32
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 50.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid?
The IUPAC name of 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid (CID 155355138) is 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid.
What is the SMILES notation for 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid?
The canonical SMILES for 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid is C=C(C)C(=O)OCCN.C=CC(=O)O.
What is the InChIKey of 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid?
The InChIKey is XGZDAGGOXCSMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C3H4O2/c1-5(2)6(8)9-4-3-7;1-2-3(4)5/h1,3-4,7H2,2H3;2H,1H2,(H,4,5).
What are the key properties of 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid?
2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid has a molecular weight of 201.22 g/mol, XLogP of 0.32, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2-methylprop-2-enoate;prop-2-enoic acid is sourced from PubChem (CID 155355138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).