C12H22O6Si — CID 158298402
3-dimethoxysilylpropyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 158298402) has the molecular formula C12H22O6Si and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-dimethoxysilylpropyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | 3-dimethoxysilylpropyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 158298402 |
| Molecular Formula | C12H22O6Si |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-dimethoxysilylpropyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCC[SiH](OC)OC.C=CC(=O)O |
| InChI | InChI=1S/C9H18O4Si.C3H4O2/c1-8(2)9(10)13-6-5-7-14(11-3)12-4;1-2-3(4)5/h14H,1,5-7H2,2-4H3;2H,1H2,(H,4,5) |
| InChIKey | GMERXDXGAPQPPQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|