About 2-dimethoxysilylethyl prop-2-enoate
2-dimethoxysilylethyl prop-2-enoate (PubChem CID 123256455) has the molecular formula C7H14O4Si
and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-dimethoxysilylethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-dimethoxysilylethyl prop-2-enoate |
| PubChem CID | 123256455 |
| Molecular Formula | C7H14O4Si |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-dimethoxysilylethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC[SiH](OC)OC |
| InChI | InChI=1S/C7H14O4Si/c1-4-7(8)11-5-6-12(9-2)10-3/h4,12H,1,5-6H2,2-3H3 |
| InChIKey | RPGSLKIRAVVCNK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethoxysilylethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethoxysilylethyl prop-2-enoate?
The IUPAC name of 2-dimethoxysilylethyl prop-2-enoate (CID 123256455) is 2-dimethoxysilylethyl prop-2-enoate.
What is the SMILES notation for 2-dimethoxysilylethyl prop-2-enoate?
The canonical SMILES for 2-dimethoxysilylethyl prop-2-enoate is C=CC(=O)OCC[SiH](OC)OC.
What is the InChIKey of 2-dimethoxysilylethyl prop-2-enoate?
The InChIKey is RPGSLKIRAVVCNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O4Si/c1-4-7(8)11-5-6-12(9-2)10-3/h4,12H,1,5-6H2,2-3H3.
What are the key properties of 2-dimethoxysilylethyl prop-2-enoate?
2-dimethoxysilylethyl prop-2-enoate has a molecular weight of 190.27 g/mol, XLogP of 0.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethoxysilylethyl prop-2-enoate is sourced from PubChem (CID 123256455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).