About 2-prop-2-enoyloxyethyl prop-2-enoate;zinc
2-prop-2-enoyloxyethyl prop-2-enoate;zinc (PubChem CID 88622091) has the molecular formula C8H10O4Zn
and a molecular weight of 235.55 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl prop-2-enoate;zinc.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl prop-2-enoate;zinc |
| PubChem CID | 88622091 |
| Molecular Formula | C8H10O4Zn |
| Molecular Weight | 235.55 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | 2-prop-2-enoyloxyethyl prop-2-enoate;zinc |
| SMILES | C=CC(=O)OCCOC(=O)C=C.[Zn] |
| InChI | InChI=1S/C8H10O4.Zn/c1-3-7(9)11-5-6-12-8(10)4-2;/h3-4H,1-2,5-6H2; |
| InChIKey | KPFGRAFXWPBIAD-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.55 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl prop-2-enoate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl prop-2-enoate;zinc?
The IUPAC name of 2-prop-2-enoyloxyethyl prop-2-enoate;zinc (CID 88622091) is 2-prop-2-enoyloxyethyl prop-2-enoate;zinc.
What is the SMILES notation for 2-prop-2-enoyloxyethyl prop-2-enoate;zinc?
The canonical SMILES for 2-prop-2-enoyloxyethyl prop-2-enoate;zinc is C=CC(=O)OCCOC(=O)C=C.[Zn].
What is the InChIKey of 2-prop-2-enoyloxyethyl prop-2-enoate;zinc?
The InChIKey is KPFGRAFXWPBIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4.Zn/c1-3-7(9)11-5-6-12-8(10)4-2;/h3-4H,1-2,5-6H2;.
What are the key properties of 2-prop-2-enoyloxyethyl prop-2-enoate;zinc?
2-prop-2-enoyloxyethyl prop-2-enoate;zinc has a molecular weight of 235.55 g/mol, XLogP of 0.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl prop-2-enoate;zinc is sourced from PubChem (CID 88622091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).