About azane;3-prop-2-enoyloxypropyl prop-2-enoate
azane;3-prop-2-enoyloxypropyl prop-2-enoate (PubChem CID 162679005) has the molecular formula C9H15NO4
and a molecular weight of 201.22 g/mol. Its IUPAC name is azane;3-prop-2-enoyloxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | azane;3-prop-2-enoyloxypropyl prop-2-enoate |
| PubChem CID | 162679005 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | azane;3-prop-2-enoyloxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC(=O)C=C.N |
| InChI | InChI=1S/C9H12O4.H3N/c1-3-8(10)12-6-5-7-13-9(11)4-2;/h3-4H,1-2,5-7H2;1H3 |
| InChIKey | XZIIVEOUOGNYLA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;3-prop-2-enoyloxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-prop-2-enoyloxypropyl prop-2-enoate?
The IUPAC name of azane;3-prop-2-enoyloxypropyl prop-2-enoate (CID 162679005) is azane;3-prop-2-enoyloxypropyl prop-2-enoate.
What is the SMILES notation for azane;3-prop-2-enoyloxypropyl prop-2-enoate?
The canonical SMILES for azane;3-prop-2-enoyloxypropyl prop-2-enoate is C=CC(=O)OCCCOC(=O)C=C.N.
What is the InChIKey of azane;3-prop-2-enoyloxypropyl prop-2-enoate?
The InChIKey is XZIIVEOUOGNYLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4.H3N/c1-3-8(10)12-6-5-7-13-9(11)4-2;/h3-4H,1-2,5-7H2;1H3.
What are the key properties of azane;3-prop-2-enoyloxypropyl prop-2-enoate?
azane;3-prop-2-enoyloxypropyl prop-2-enoate has a molecular weight of 201.22 g/mol, XLogP of 1.00, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-prop-2-enoyloxypropyl prop-2-enoate is sourced from PubChem (CID 162679005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).