About 3-carbamoyloxypropyl prop-2-enoate
3-carbamoyloxypropyl prop-2-enoate (PubChem CID 58831010) has the molecular formula C7H11NO4
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-carbamoyloxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-carbamoyloxypropyl prop-2-enoate |
| PubChem CID | 58831010 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-carbamoyloxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOC(N)=O |
| InChI | InChI=1S/C7H11NO4/c1-2-6(9)11-4-3-5-12-7(8)10/h2H,1,3-5H2,(H2,8,10) |
| InChIKey | RPZOCHDHNBYMAO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-carbamoyloxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carbamoyloxypropyl prop-2-enoate?
The IUPAC name of 3-carbamoyloxypropyl prop-2-enoate (CID 58831010) is 3-carbamoyloxypropyl prop-2-enoate.
What is the SMILES notation for 3-carbamoyloxypropyl prop-2-enoate?
The canonical SMILES for 3-carbamoyloxypropyl prop-2-enoate is C=CC(=O)OCCCOC(N)=O.
What is the InChIKey of 3-carbamoyloxypropyl prop-2-enoate?
The InChIKey is RPZOCHDHNBYMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO4/c1-2-6(9)11-4-3-5-12-7(8)10/h2H,1,3-5H2,(H2,8,10).
What are the key properties of 3-carbamoyloxypropyl prop-2-enoate?
3-carbamoyloxypropyl prop-2-enoate has a molecular weight of 173.17 g/mol, XLogP of 0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamoyloxypropyl prop-2-enoate is sourced from PubChem (CID 58831010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).