About 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate
4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate (PubChem CID 158256375) has the molecular formula C22H32O8
and a molecular weight of 424.49 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate.
Molecular Properties
| Compound Name | 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate |
| PubChem CID | 158256375 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)C=C.C=CC(=O)OCCCCOC(=O)C=C |
| InChI | InChI=1S/C12H18O4.C10H14O4/c1-3-11(13)15-9-7-5-6-8-10-16-12(14)4-2;1-3-9(11)13-7-5-6-8-14-10(12)4-2/h3-4H,1-2,5-10H2;3-4H,1-2,5-8H2 |
| InChIKey | GHIKEEAWQAMIFA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate?
The IUPAC name of 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate (CID 158256375) is 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate.
What is the SMILES notation for 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate?
The canonical SMILES for 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate is C=CC(=O)OCCCCCCOC(=O)C=C.C=CC(=O)OCCCCOC(=O)C=C.
What is the InChIKey of 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate?
The InChIKey is GHIKEEAWQAMIFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4.C10H14O4/c1-3-11(13)15-9-7-5-6-8-10-16-12(14)4-2;1-3-9(11)13-7-5-6-8-14-10(12)4-2/h3-4H,1-2,5-10H2;3-4H,1-2,5-8H2.
What are the key properties of 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate?
4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate has a molecular weight of 424.49 g/mol, XLogP of 3.23, 16 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoyloxybutyl prop-2-enoate;6-prop-2-enoyloxyhexyl prop-2-enoate is sourced from PubChem (CID 158256375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).