About 11-hydroxyundecyl prop-2-enoate
11-hydroxyundecyl prop-2-enoate (PubChem CID 54223498) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 11-hydroxyundecyl prop-2-enoate.
Molecular Properties
| Compound Name | 11-hydroxyundecyl prop-2-enoate |
| PubChem CID | 54223498 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 11-hydroxyundecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCCCCO |
| InChI | InChI=1S/C14H26O3/c1-2-14(16)17-13-11-9-7-5-3-4-6-8-10-12-15/h2,15H,1,3-13H2 |
| InChIKey | QEGIOGSAGXFTLO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 11-hydroxyundecyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-hydroxyundecyl prop-2-enoate?
The IUPAC name of 11-hydroxyundecyl prop-2-enoate (CID 54223498) is 11-hydroxyundecyl prop-2-enoate.
What is the SMILES notation for 11-hydroxyundecyl prop-2-enoate?
The canonical SMILES for 11-hydroxyundecyl prop-2-enoate is C=CC(=O)OCCCCCCCCCCCO.
What is the InChIKey of 11-hydroxyundecyl prop-2-enoate?
The InChIKey is QEGIOGSAGXFTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-2-14(16)17-13-11-9-7-5-3-4-6-8-10-12-15/h2,15H,1,3-13H2.
What are the key properties of 11-hydroxyundecyl prop-2-enoate?
11-hydroxyundecyl prop-2-enoate has a molecular weight of 242.36 g/mol, XLogP of 3.22, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-hydroxyundecyl prop-2-enoate is sourced from PubChem (CID 54223498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).