C10H14O4 — CID 57033268
2-prop-2-enoyloxyethyl 2-methylidenebutanoate (PubChem CID 57033268) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 2-methylidenebutanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 2-methylidenebutanoate |
|---|---|
| PubChem CID | 57033268 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 2-methylidenebutanoate |
| SMILES | C=CC(=O)OCCOC(=O)C(=C)CC |
| InChI | InChI=1S/C10H14O4/c1-4-8(3)10(12)14-7-6-13-9(11)5-2/h5H,2-4,6-7H2,1H3 |
| InChIKey | DABGNQPGBXRHGH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|