C10H14O6 — CID 174382959
2-prop-2-enoyloxyethyl 4,4-dihydroxy-2-methylidenebutanoate (PubChem CID 174382959) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 4,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 4,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 174382959 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 4,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=CC(=O)OCCOC(=O)C(=C)CC(O)O |
| InChI | InChI=1S/C10H14O6/c1-3-9(13)15-4-5-16-10(14)7(2)6-8(11)12/h3,8,11-12H,1-2,4-6H2 |
| InChIKey | AKDRUDDNQUKSJB-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|