C30H42O13 — CID 159354100
2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate (PubChem CID 159354100) has the molecular formula C30H42O13 and a molecular weight of 610.65 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 159354100 |
| Molecular Formula | C30H42O13 |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate;2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.C=C(C)C(=O)OCCOCCOC(=O)C(=C)C.C=CC(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C12H18O5.C10H14O4.C8H10O4/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4;1-7(2)9(11)13-5-6-14-10(12)8(3)4;1-3-7(9)11-5-6-12-8(10)4-2/h1,3,5-8H2,2,4H3;1,3,5-6H2,2,4H3;3-4H,1-2,5-6H2 |
| InChIKey | LHRXAETVFKHVGN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|