C25H38O8 — CID 160866067
2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;9-prop-2-enoyloxynonyl prop-2-enoate (PubChem CID 160866067) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;9-prop-2-enoyloxynonyl prop-2-enoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;9-prop-2-enoyloxynonyl prop-2-enoate |
|---|---|
| PubChem CID | 160866067 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;9-prop-2-enoyloxynonyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.C=CC(=O)OCCCCCCCCCOC(=O)C=C |
| InChI | InChI=1S/C15H24O4.C10H14O4/c1-3-14(16)18-12-10-8-6-5-7-9-11-13-19-15(17)4-2;1-7(2)9(11)13-5-6-14-10(12)8(3)4/h3-4H,1-2,5-13H2;1,3,5-6H2,2,4H3 |
| InChIKey | SLDCETDLAORBNP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|