C29H54O4 — CID 87991734
butyl 2-methylprop-2-enoate;octadecyl prop-2-enoate (PubChem CID 87991734) has the molecular formula C29H54O4 and a molecular weight of 466.75 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;octadecyl prop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;octadecyl prop-2-enoate |
|---|---|
| PubChem CID | 87991734 |
| Molecular Formula | C29H54O4 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.40 |
| IUPAC Name | butyl 2-methylprop-2-enoate;octadecyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC.C=CC(=O)OCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C21H40O2.C8H14O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21(22)4-2;1-4-5-6-10-8(9)7(2)3/h4H,2-3,5-20H2,1H3;2,4-6H2,1,3H3 |
| InChIKey | BIYKKFRWHCLLLN-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|