C22H40O5 — CID 87841957
2-hydroxyethyl prop-2-enoate;tridecyl 2-methylprop-2-enoate (PubChem CID 87841957) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;tridecyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxyethyl prop-2-enoate;tridecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87841957 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;tridecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCCC.C=CC(=O)OCCO |
| InChI | InChI=1S/C17H32O2.C5H8O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-19-17(18)16(2)3;1-2-5(7)8-4-3-6/h2,4-15H2,1,3H3;2,6H,1,3-4H2 |
| InChIKey | DSXAWRNOFCGGBV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|