C18H30O7 — CID 159958630
butyl prop-2-enoate;ethyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 159958630) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is butyl prop-2-enoate;ethyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | butyl prop-2-enoate;ethyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159958630 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | butyl prop-2-enoate;ethyl prop-2-enoate;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=CC(=O)OCC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C7H12O2.C6H10O3.C5H8O2/c1-3-5-6-9-7(8)4-2;1-5(2)6(8)9-4-3-7;1-3-5(6)7-4-2/h4H,2-3,5-6H2,1H3;7H,1,3-4H2,2H3;3H,1,4H2,2H3 |
| InChIKey | ODAOJXOZAZPJQV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|