C25H44O7 — CID 158734607
2-hydroxyethyl 2-methylprop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;octyl prop-2-enoate (PubChem CID 158734607) has the molecular formula C25H44O7 and a molecular weight of 456.62 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;octyl prop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;octyl prop-2-enoate |
|---|---|
| PubChem CID | 158734607 |
| Molecular Formula | C25H44O7 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;octyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)C.C=C(C)C(=O)OCCO.C=CC(=O)OCCCCCCCC |
| InChI | InChI=1S/C11H20O2.C8H14O2.C6H10O3/c1-3-5-6-7-8-9-10-13-11(12)4-2;1-6(2)5-10-8(9)7(3)4;1-5(2)6(8)9-4-3-7/h4H,2-3,5-10H2,1H3;6H,3,5H2,1-2,4H3;7H,1,3-4H2,2H3 |
| InChIKey | ILNGEKAVVOMKSS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|