C24H44O6 — CID 174913264
butyl 2-methylprop-2-enoate;2-methylpropane;methyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate (PubChem CID 174913264) has the molecular formula C24H44O6 and a molecular weight of 428.61 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-methylpropane;methyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;2-methylpropane;methyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174913264 |
| Molecular Formula | C24H44O6 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-methylpropane;methyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)C.C=C(C)C(=O)OCCCC.C=CC(=O)OC.CC(C)C |
| InChI | InChI=1S/2C8H14O2.C4H6O2.C4H10/c1-6(2)5-10-8(9)7(3)4;1-4-5-6-10-8(9)7(2)3;1-3-4(5)6-2;1-4(2)3/h6H,3,5H2,1-2,4H3;2,4-6H2,1,3H3;3H,1H2,2H3;4H,1-3H3 |
| InChIKey | BMOMCKINLNRHQB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|