C14H24O5 — CID 172788583
butyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate (PubChem CID 172788583) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is butyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate.
| Compound Name | butyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172788583 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | butyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)O.C=CC(=O)OCCCC |
| InChI | InChI=1S/C7H12O3.C7H12O2/c1-5(2)7(9)10-4-6(3)8;1-3-5-6-9-7(8)4-2/h6,8H,1,4H2,2-3H3;4H,2-3,5-6H2,1H3 |
| InChIKey | PGBVSZNHPJHRGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|