C24H40O12 — CID 159540810
2-hydroxyethyl 2-methylprop-2-enoate;2-hydroxyethyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate;2-hydroxypropyl prop-2-enoate (PubChem CID 159540810) has the molecular formula C24H40O12 and a molecular weight of 520.57 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;2-hydroxyethyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate;2-hydroxypropyl prop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-hydroxyethyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate;2-hydroxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 159540810 |
| Molecular Formula | C24H40O12 |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;2-hydroxyethyl prop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate;2-hydroxypropyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)O.C=C(C)C(=O)OCCO.C=CC(=O)OCC(C)O.C=CC(=O)OCCO |
| InChI | InChI=1S/C7H12O3.2C6H10O3.C5H8O3/c1-5(2)7(9)10-4-6(3)8;1-5(2)6(8)9-4-3-7;1-3-6(8)9-4-5(2)7;1-2-5(7)8-4-3-6/h6,8H,1,4H2,2-3H3;7H,1,3-4H2,2H3;3,5,7H,1,4H2,2H3;2,6H,1,3-4H2 |
| InChIKey | MEEJQCKVKBKCGF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|