C10H16O6 — CID 159156853
2-hydroxyethyl prop-2-enoate;hydroxymethyl 2-methylprop-2-enoate (PubChem CID 159156853) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;hydroxymethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxyethyl prop-2-enoate;hydroxymethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159156853 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;hydroxymethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCO.C=CC(=O)OCCO |
| InChI | InChI=1S/2C5H8O3/c1-4(2)5(7)8-3-6;1-2-5(7)8-4-3-6/h6H,1,3H2,2H3;2,6H,1,3-4H2 |
| InChIKey | KJZRFMLJUDFNDA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|