C12H20O5 — CID 163613282
2-buta-1,3-dien-2-yloxyethanol;2-hydroxyethyl 2-methylprop-2-enoate (PubChem CID 163613282) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yloxyethanol;2-hydroxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-buta-1,3-dien-2-yloxyethanol;2-hydroxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163613282 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-buta-1,3-dien-2-yloxyethanol;2-hydroxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCO.C=CC(=C)OCCO |
| InChI | InChI=1S/C6H10O3.C6H10O2/c1-5(2)6(8)9-4-3-7;1-3-6(2)8-5-4-7/h7H,1,3-4H2,2H3;3,7H,1-2,4-5H2 |
| InChIKey | HHUHTOYOUFZMME-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|