C11H18O5 — CID 175328029
2-hydroxyethyl 2-methylprop-2-enoate;prop-2-enyl acetate (PubChem CID 175328029) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;prop-2-enyl acetate.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;prop-2-enyl acetate |
|---|---|
| PubChem CID | 175328029 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;prop-2-enyl acetate |
| SMILES | C=C(C)C(=O)OCCO.C=CCOC(C)=O |
| InChI | InChI=1S/C6H10O3.C5H8O2/c1-5(2)6(8)9-4-3-7;1-3-4-7-5(2)6/h7H,1,3-4H2,2H3;3H,1,4H2,2H3 |
| InChIKey | IQARDSCKDWQGQC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|