C10H14O5 — CID 88775356
2-prop-2-enoxycarbonyloxyethyl 2-methylprop-2-enoate (PubChem CID 88775356) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-prop-2-enoxycarbonyloxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-prop-2-enoxycarbonyloxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88775356 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-prop-2-enoxycarbonyloxyethyl 2-methylprop-2-enoate |
| SMILES | C=CCOC(=O)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C10H14O5/c1-4-5-14-10(12)15-7-6-13-9(11)8(2)3/h4H,1-2,5-7H2,3H3 |
| InChIKey | WPBMGCFYKOIHBY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|