C37H68O4 — CID 173068986
2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;nonakis(prop-1-ene) (PubChem CID 173068986) has the molecular formula C37H68O4 and a molecular weight of 576.95 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;nonakis(prop-1-ene).
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;nonakis(prop-1-ene) |
|---|---|
| PubChem CID | 173068986 |
| Molecular Formula | C37H68O4 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.51 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate;nonakis(prop-1-ene) |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=C)C.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC |
| InChI | InChI=1S/C10H14O4.9C3H6/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;9*1-3-2/h1,3,5-6H2,2,4H3;9*3H,1H2,2H3 |
| InChIKey | GLKYBYYHBHVBQN-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|