C6H10O4 — CID 18987502
2-hydroperoxyethyl 2-methylprop-2-enoate (PubChem CID 18987502) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is 2-hydroperoxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroperoxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18987502 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-hydroperoxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOO |
| InChI | InChI=1S/C6H10O4/c1-5(2)6(7)9-3-4-10-8/h8H,1,3-4H2,2H3 |
| InChIKey | TXDFGTVQBMTQJY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|