C11H16O6 — CID 153485149
2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-propyl oxalate (PubChem CID 153485149) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-propyl oxalate.
| Compound Name | 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-propyl oxalate |
|---|---|
| PubChem CID | 153485149 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-O-[2-(2-methylprop-2-enoyloxy)ethyl] 1-O-propyl oxalate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C(=O)OCCC |
| InChI | InChI=1S/C11H16O6/c1-4-5-15-10(13)11(14)17-7-6-16-9(12)8(2)3/h2,4-7H2,1,3H3 |
| InChIKey | DNUPCFQYFNPKAC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|