About propane;propyl 2-methylprop-2-enoate;yttrium
propane;propyl 2-methylprop-2-enoate;yttrium (PubChem CID 158346337) has the molecular formula C10H19O2Y-
and a molecular weight of 260.17 g/mol. Its IUPAC name is propane;propyl 2-methylprop-2-enoate;yttrium.
Molecular Properties
| Compound Name | propane;propyl 2-methylprop-2-enoate;yttrium |
| PubChem CID | 158346337 |
| Molecular Formula | C10H19O2Y- |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | propane;propyl 2-methylprop-2-enoate;yttrium |
| SMILES | C=C(C)C(=O)OCCC.[CH2-]CC.[Y] |
| InChI | InChI=1S/C7H12O2.C3H7.Y/c1-4-5-9-7(8)6(2)3;1-3-2;/h2,4-5H2,1,3H3;1,3H2,2H3;/q;-1; |
| InChIKey | KCNZCZYJWUBTRU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propane;propyl 2-methylprop-2-enoate;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;propyl 2-methylprop-2-enoate;yttrium?
The IUPAC name of propane;propyl 2-methylprop-2-enoate;yttrium (CID 158346337) is propane;propyl 2-methylprop-2-enoate;yttrium.
What is the SMILES notation for propane;propyl 2-methylprop-2-enoate;yttrium?
The canonical SMILES for propane;propyl 2-methylprop-2-enoate;yttrium is C=C(C)C(=O)OCCC.[CH2-]CC.[Y].
What is the InChIKey of propane;propyl 2-methylprop-2-enoate;yttrium?
The InChIKey is KCNZCZYJWUBTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C3H7.Y/c1-4-5-9-7(8)6(2)3;1-3-2;/h2,4-5H2,1,3H3;1,3H2,2H3;/q;-1;.
What are the key properties of propane;propyl 2-methylprop-2-enoate;yttrium?
propane;propyl 2-methylprop-2-enoate;yttrium has a molecular weight of 260.17 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;propyl 2-methylprop-2-enoate;yttrium is sourced from PubChem (CID 158346337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).