C11H20O3 — CID 175153553
oxolane;propyl 2-methylprop-2-enoate (PubChem CID 175153553) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is oxolane;propyl 2-methylprop-2-enoate.
| Compound Name | oxolane;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175153553 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | oxolane;propyl 2-methylprop-2-enoate |
| SMILES | C1CCOC1.C=C(C)C(=O)OCCC |
| InChI | InChI=1S/C7H12O2.C4H8O/c1-4-5-9-7(8)6(2)3;1-2-4-5-3-1/h2,4-5H2,1,3H3;1-4H2 |
| InChIKey | ZRBGCYJOFGPKFC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|