C14H28O3Si — CID 23091826
butyl 2-methylprop-2-enoate;2,2-dimethyloxasilinane (PubChem CID 23091826) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2,2-dimethyloxasilinane.
| Compound Name | butyl 2-methylprop-2-enoate;2,2-dimethyloxasilinane |
|---|---|
| PubChem CID | 23091826 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2,2-dimethyloxasilinane |
| SMILES | C=C(C)C(=O)OCCCC.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C8H14O2.C6H14OSi/c1-4-5-6-10-8(9)7(2)3;1-8(2)6-4-3-5-7-8/h2,4-6H2,1,3H3;3-6H2,1-2H3 |
| InChIKey | WHFOQCVOLTTZDS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|