C8H16O2Sn — CID 173448670
butyl 2-methylprop-2-enoate;λ2-stannane (PubChem CID 173448670) has the molecular formula C8H16O2Sn and a molecular weight of 262.92 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;λ2-stannane.
| Compound Name | butyl 2-methylprop-2-enoate;λ2-stannane |
|---|---|
| PubChem CID | 173448670 |
| Molecular Formula | C8H16O2Sn |
| Molecular Weight | 262.92 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | butyl 2-methylprop-2-enoate;λ2-stannane |
| SMILES | C=C(C)C(=O)OCCCC.[SnH2] |
| InChI | InChI=1S/C8H14O2.Sn.2H/c1-4-5-6-10-8(9)7(2)3;;;/h2,4-6H2,1,3H3;;; |
| InChIKey | HZLARALRSLIKKA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.92 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|