C14H28O2 — CID 174847930
methane;nonyl 2-methylprop-2-enoate (PubChem CID 174847930) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is methane;nonyl 2-methylprop-2-enoate.
| Compound Name | methane;nonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174847930 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | methane;nonyl 2-methylprop-2-enoate |
| SMILES | C.C=C(C)C(=O)OCCCCCCCCC |
| InChI | InChI=1S/C13H24O2.CH4/c1-4-5-6-7-8-9-10-11-15-13(14)12(2)3;/h2,4-11H2,1,3H3;1H4 |
| InChIKey | KDAXTLACSQSXRS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|