C23H42O4 — CID 87150170
dodecyl 2-methylprop-2-enoate;propyl 2-methylprop-2-enoate (PubChem CID 87150170) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is dodecyl 2-methylprop-2-enoate;propyl 2-methylprop-2-enoate.
| Compound Name | dodecyl 2-methylprop-2-enoate;propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87150170 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | dodecyl 2-methylprop-2-enoate;propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC.C=C(C)C(=O)OCCCCCCCCCCCC |
| InChI | InChI=1S/C16H30O2.C7H12O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-4-5-9-7(8)6(2)3/h2,4-14H2,1,3H3;2,4-5H2,1,3H3 |
| InChIKey | XGCWMVRYIQAMQU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|