C14H26O3 — CID 139797922
5-pentoxypentyl 2-methylprop-2-enoate (PubChem CID 139797922) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 5-pentoxypentyl 2-methylprop-2-enoate.
| Compound Name | 5-pentoxypentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139797922 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 5-pentoxypentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCOCCCCC |
| InChI | InChI=1S/C14H26O3/c1-4-5-7-10-16-11-8-6-9-12-17-14(15)13(2)3/h2,4-12H2,1,3H3 |
| InChIKey | SOXCAWDQDRNWGX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|