About butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate
butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate (PubChem CID 88636576) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate |
| PubChem CID | 88636576 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCCOC |
| InChI | InChI=1S/C8H14O2.C7H12O3/c1-4-5-6-10-8(9)7(2)3;1-6(2)7(8)10-5-4-9-3/h2,4-6H2,1,3H3;1,4-5H2,2-3H3 |
| InChIKey | AUKXGUSTDAZLLC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate?
The IUPAC name of butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate (CID 88636576) is butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate.
What is the SMILES notation for butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate?
The canonical SMILES for butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCCOC.
What is the InChIKey of butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate?
The InChIKey is AUKXGUSTDAZLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C7H12O3/c1-4-5-6-10-8(9)7(2)3;1-6(2)7(8)10-5-4-9-3/h2,4-6H2,1,3H3;1,4-5H2,2-3H3.
What are the key properties of butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate?
butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate has a molecular weight of 286.37 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-methylprop-2-enoate;2-methoxyethyl 2-methylprop-2-enoate is sourced from PubChem (CID 88636576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).