C10H20O5S — CID 175093027
butyl 2-methylprop-2-enoate;methyl methanesulfonate (PubChem CID 175093027) has the molecular formula C10H20O5S and a molecular weight of 252.33 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;methyl methanesulfonate.
| Compound Name | butyl 2-methylprop-2-enoate;methyl methanesulfonate |
|---|---|
| PubChem CID | 175093027 |
| Molecular Formula | C10H20O5S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | butyl 2-methylprop-2-enoate;methyl methanesulfonate |
| SMILES | C=C(C)C(=O)OCCCC.COS(C)(=O)=O |
| InChI | InChI=1S/C8H14O2.C2H6O3S/c1-4-5-6-10-8(9)7(2)3;1-5-6(2,3)4/h2,4-6H2,1,3H3;1-2H3 |
| InChIKey | LJKDFCWXARRHKN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|