C12H22O3 — CID 58788817
7-methoxyheptyl 2-methylprop-2-enoate (PubChem CID 58788817) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 7-methoxyheptyl 2-methylprop-2-enoate.
| Compound Name | 7-methoxyheptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58788817 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 7-methoxyheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCOC |
| InChI | InChI=1S/C12H22O3/c1-11(2)12(13)15-10-8-6-4-5-7-9-14-3/h1,4-10H2,2-3H3 |
| InChIKey | PVNROYDLMDOYAW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|