C19H32O3 — CID 176866150
10-(3-methylbuta-1,3-dien-2-yloxy)decyl 2-methylprop-2-enoate (PubChem CID 176866150) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 10-(3-methylbuta-1,3-dien-2-yloxy)decyl 2-methylprop-2-enoate.
| Compound Name | 10-(3-methylbuta-1,3-dien-2-yloxy)decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176866150 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 10-(3-methylbuta-1,3-dien-2-yloxy)decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=C)OCCCCCCCCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C19H32O3/c1-16(2)18(5)21-14-12-10-8-6-7-9-11-13-15-22-19(20)17(3)4/h1,3,5-15H2,2,4H3 |
| InChIKey | PGYSUIUSARCODW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|